Zu "79094-20-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Daltroban
Artikelnummer: TGM-T15049-100mg
Description: Daltroban (SKF 96148) is a specific thromboxane A2 (TXA2) receptor antagonist. Daltroban shows protective effect in reperfusion injury. Daltroban increase intracellular calcium in vascular smooth muscle cells. Target: PPAR. Smiles: OC(=O)Cc1ccc(CCNS(=O)(=O)c2ccc(Cl)cc2)cc1. References: Miki I, et al....
| Schlagworte: | BM-13505, SKF 96148 |
| Anwendung: | Targets thromboxane A2 receptor (TBXA2R) |
| CAS | 79094-20-5 |
| MW: | 353.82 D |
ab 54,00 €
Daltroban
Artikelnummer: Cay14061-5
Daltroban is a thromboxane receptor (TP) antagonist. It inhibits aggregation of isolated human platelets induced by the TP agonist U-46619 (Item no. 16450, IC50 = 77 nM). Daltroban increases mean pulmonary arterial pressure (MPAP), mean arterial pressure (MAP), and hematocrit levels in anesthetized rats (ED50s = 20,...
| Schlagworte: | BM 13505, SKF 96148, 4-[2-[[(4-chlorophenyl)sulfonyl]amino]ethyl]-benzeneacetic acid |
| Anwendung: | Thromboxane A2 (TXA2) receptor antagonist |
| CAS | 79094-20-5 |
| MW: | 353.8 D |
ab 59,00 €
