Zu "78606-80-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5(S),6(R)-7-trihydroxymethyl Heptanoate
Artikelnummer: Cay10005032-1
Lipoxins are trihydroxytetraene metabolites derived from arachidonic acid through an interaction between lipoxygenases with C-5 and C-15 specificities. Lipoxin A4 (LXA4) inhibits the chemotactic responsiveness of polymorphonuclear (PMN) neutrophils to leukotriene B4 and to the peptide...
| Schlagworte: | BML-111, 5S,6R-trihydroxy-7-heptanoic acid, methyl ester |
| Anwendung: | PMN chemotaxis inhibition |
| CAS | 78606-80-1 |
| MW: | 192.2 D |
ab 78,00 €
BML-111
Artikelnummer: TGM-T22526-100mg
Description: inhibits leukotriene B4 (LTB4)-induced polymorphonuclear neutrophils (PMN) chemotaxis. Target: Others. Smiles: COC(=O)CCC[C@H](O)[C@H](O)CO
| Schlagworte: | 5(S),6(R)-7-trihydroxymethyl Heptanoate |
| CAS | 78606-80-1 |
| MW: | 192.21 D |
ab 492,00 €
