Zu "78033-08-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
8-Methoxymethyl-3-isobutyl-1-methylxanthine
Artikelnummer: Cay39151-1
8-Methoxymethyl-3-isobutyl-1-methylxanthine is an inhibitor of phosphodiesterase 1 (PDE1, IC50 = 5 µM) and a derivative of IBMX (Cay-13347). It is selective for PDE1 over PDE2, PDE3, and PDE4 but also inhibits PDE5 (IC50s = 37, >400, >400, and 2 µM, respectively). 8-Methoxymethyl-3-isobutyl-1-methylxanthine (30 µM)...
| Schlagworte: | 8-MeOMeMIX, 8-methoxymethyl IBMX, 8-MM-IBMX, MMPX,... |
| Anwendung: | PDE1 inhibitor |
| CAS | 78033-08-6 |
| MW: | 266.3 D |
ab 63,00 €
MMPX
Artikelnummer: TGM-T23009-10mg
Description: calmodulin-sensitive cyclic GMP phosphodiesterase inhibitor. Target: Others. Smiles: COCC1=NC2=C(N1)N(CC(C)C)C(=O)N(C)C2=O
| CAS | 78033-08-6 |
| MW: | 266.3 D |
ab 114,00 €
