Zu "78028-01-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CAY10397
Artikelnummer: TGM-T26956-10mg
Description: CAY10397, a selective inhibitor of 15-hydroxy PGDH, significantly suppresses endogenous 11-oxo-ETE production with a corresponding increase in 11(R)-HETE. Target: Others. Smiles: N(=NC1=CC=C(C(OCC)=O)C=C1)C2=CC(CC(O)=O)=C(O)C=C2. References: Liu X, Zhang S, Arora JS, Snyder NW, Shah SJ, Blair IA....
| CAS | 78028-01-0 |
| MW: | 328.32 D |
ab 147,00 €
CAY10397
Artikelnummer: Cay70130-1
Prostaglandins are rapidly inactivated in vivo by the action of 15-hydroxy prostaglandin dehydrogenase (15-hydroxy PGDH). This enzyme oxidizes the 15-hydroxyl group and hydrogenates the 13,14-double bond, producing 13,14-dihydro-15 keto metabolites with greatly reduced biological activity. CAY10397 is a selective...
| Schlagworte: | CK47A, 5-[[4-(ethoxycarbonyl)phenyl]azo]-2-hydroxy-benzeneacetic acid |
| Anwendung: | 15-hydroxy PGDH inhibitor |
| CAS | 78028-01-0 |
| MW: | 328.3 D |
ab 81,00 €
