Zu "76939-46-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
8-Bromo-cAMP sodium salt
Artikelnummer: TGM-T6747-100mg
Description: 8-Bromo-cAMP sodium salt (8-Br-Camp sodium salt) is a long-acting derivative of cyclic AMP. It is an activator of cyclic AMP-dependent protein kinase(PKA), but resistant to degradation by cyclic AMP phosphodiesterase. Target: PKA. Smiles: [Na+].Nc1ncnc2n(C3OC4COP([O-])(=O)OC4C3O)c(Br)nc12. References:...
| Schlagworte: | 8-Bromo-cAMP(sodium salt), 8-Bromo-cAMP, 8-Br-Camp sodium salt |
| Anwendung: | cAMP analog, PKA activator |
| CAS | 76939-46-3 |
| MW: | 430.08 D |
ab 42,00 €
8-bromo Cyclic AMP (sodium salt)
Artikelnummer: Cay14431-25
8-bromo Cyclic AMP is an activator of protein kinase A (PKA) with a half-maximal activation (Ka) value of 0.05 µM. It is selective for PKA over cGMP-dependent protein kinase (PKG, Ka = 5.8 µM) and is more resistant to hydrolysis by phosphodiesterases (PDEs) compared with cAMP (Cay-18820). 8-bromo Cyclic AMP inhibits...
| Schlagworte: | 8-bromo-cAMP, 8-Bromoadenosine 3',5'-cyclic monophosphate, 8-bromo-cyclic 3',5'-(hydrogen phosphate)-adenosine, monosodium... |
| Anwendung: | cAMP analog, PKA activator |
| CAS | 76939-46-3 |
| MW: | 430.1 D |
ab 52,00 €
