Zu "7659-29-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
3,5-Dinitrocatechol
Artikelnummer: Cay29180-1
3,5-Dinitrocatechol is a potent catechol O-methyltransferase (COMT) inhibitor (IC50 = 12 nM). It is selective for COMT over tyrosine hydroxylase, dopamine beta-hydroxylase, dopamine decarboxylase, monoamine oxidase A (MAO-A), and MAO-B (IC50s = >14 µM for all). 3,5-Dintrocatechol (30 mg/kg), in combination with...
| Schlagworte: | OR-486, 3,5-dinitro-1,2-benzenediol |
| Anwendung: | Potent COMT inhibitor |
| CAS | 7659-29-2 |
| MW: | 200.1 D |
ab 44,00 €
3,5-Dinitrocatechol
Artikelnummer: TGM-T23109-10mg
Description: OR-486 is an inhibitor of catechol-O-methyl-transferase(COMT) and can be used to prepare the molybdenum (VI)- 3,5-Dinitrocatechol complex. Target: Transferase. Smiles: OC1=CC(=CC(=C1O)[N+]([O-])=O)[N+]([O-])=O. References: Yamaki F, et, al. Effects of Catecholamine Metabolites on...
| CAS | 7659-29-2 |
| MW: | 200.11 D |
ab 33,00 €
