Zu "76135-30-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
7-hydroxy DPAT (hydrobromide)
Artikelnummer: Cay29516-10
7-hydroxy DPAT is a dopamine D3 receptor agonist. It selectively binds to the dopamine D3 over the D2, D1, and D4 receptors (Kis = 0.78, 61, 650, and 5,300 nM, respectively, in radioligand binding assays). 7-hydroxy DPAT increases calcium mobilization in HEK293 cells expressing the D3 receptor with an EC50 value of...
| Schlagworte: | 7-(dipropylamino)-5,6,7,8-tetrahydro-2-naphthalenol, monohydrobromide |
| Anwendung: | Dopamine D3 receptor agonist |
| CAS | 76135-30-3 |
| MW: | 328.3 D |
ab 66,00 €
7-Hydroxy-DPAT hydrobromide
Artikelnummer: TGM-T22531-10mg
Description: D3 dopamine receptor agonist. Target: Others. Smiles: Br.OC1=CC=C2C(=C1)CC(N(CCC)CCC)CC2
| Anwendung: | Dopamine D3 receptor agonist |
| CAS | 76135-30-3 |
| MW: | 328.29 D |
ab 120,00 €
