Zu "75847-73-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Enalapril
Artikelnummer: TGM-T1605-100mg
Description: Enalapril is a dicarbocyl-containing peptide and angiotensin-converting enzyme (ACE) inhibitor with antihypertensive activity. Target: MRP, RAAS. Smiles: CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2CCC[C@H]2C(=O)O. References: Andujar-Sanchez M, et al. FEBS Lett. 2007 Jul 24,581(18):3449-54.
| Schlagworte: | MK-421 |
| Anwendung: | Targets peptidyl-dipeptidase A [EC:3.4.15.1] (ACE, CD143) |
| CAS | 75847-73-3 |
| MW: | 376.45 D |
ab 31,00 €
Enalapril
Artikelnummer: LKT-E5202.1
An antihypertensive agent known to reduce the incidence of vascular dementia and Alzheimer's disease. Found to have a potential for colon cancer prevention. (ACE inhibitor)
| Schlagworte: | N-[(1S)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline |
| Anwendung: | ACE inhibitor |
| CAS | 75847-73-3 |
| MW: | 376,45 D |
ab 557,00 €
Enalapril
Artikelnummer: LKT-E5202.100
An antihypertensive agent known to reduce the incidence of vascular dementia and Alzheimer's disease. Found to have a potential for colon cancer prevention. (ACE inhibitor)
| Schlagworte: | RenitecR, VasotecR, N-[(1S)-1-(Ethoxycarbonyl)-3-phenylpropyl]-L-alanyl-L-proline |
| Anwendung: | ACE inhibitor |
| CAS | 75847-73-3 |
| MW: | 376.45 D |
ab 128,00 €
