Zu "755038-65-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Volasertib
Artikelnummer: TGM-T6019-100mg
Description: Volasertib (BI 6727) (BI-6727) is a potent inhibitor of PLK1 (IC50: 0.87 nM), inducing mitotic arrest and apoptosis. It also inhibits PLK2/PLK3 (IC50s: 5/56 nM). Target: Apoptosis, PLK. Smiles: CC[C@H]1N(C(C)C)c2nc(Nc3ccc(cc3OC)C(=O)N[C@H]3CC[C@@H](CC3)N3CCN(CC4CC4)CC3)ncc2N(C)C1=O. References: Rudolph...
| Schlagworte: | BI 6727 |
| Anwendung: | Targets polo-like kinase 1 [EC:2.7.11.21] (PLK1) |
| CAS | 755038-65-4 |
| MW: | 618.81 D |
ab 40,00 €
BI-6727
Artikelnummer: Cay18193-1
Polo-like kinases (Plks) are serine/threonine kinases with key roles in cell cycling. BI-6727 is a dihydropteridinone that inhibits Plk1, Plk2, and Plk3 (IC50s = 0.87, 5, and 56 nM, respectively), inducing mitotic arrest and apoptosis. It inhibits proliferation of multiple cancer cell lines with EC50 values ranging...
| Schlagworte: | Volasertib,... |
| Anwendung: | PLK1/2/3 inhibitor |
| CAS | 755038-65-4 |
| MW: | 618.8 D |
ab 52,00 €
BI-6727
Artikelnummer: LKT-B3300.1
PLK1 inhibitor.
| Schlagworte: | BI6727, Volasertib |
| Anwendung: | Polo-like Kinase 1 (PLK1) inhibitor |
| CAS | 755038-65-4 |
| MW: | 618.81 D |
ab 198,00 €
