Zu "71441-28-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TTNPB
Artikelnummer: TGM-T1288-100mg
Description: TTNPB (Ro 13-7410,AGN-191183), a potent RAR agonist, inhibits binding of [3H]tRA of human RARalpha (IC50: 5.1 nM), beta (IC50: 4.5 nM), and gamma (IC50: 9.3 nM), respectively. Target: Autophagy, Apoptosis, Retinoid Receptor. Smiles: CC(=Cc1ccc(cc1)C(O)=O)c1ccc2c(c1)C(C)(C)CCC2(C)C. References:...
| Schlagworte: | Arotinoid acid, Ro 13-7410,AGN-191183, AGN191183, Ro 13-7410 |
| Anwendung: | Retinoic acid receptor agonist |
| CAS | 71441-28-6 |
| MW: | 348.48 D |
ab 33,00 €
TTNPB
Artikelnummer: Cay16144-1
TTNPB is an analog of retinoic acid (Cay-11017) that potently and selectively activates retinoic acid receptors (EC50s = 21, 4, and 2.4 nM for RARalpha, RARbeta, and RARgamma, respectively). It does not act on retinoid X receptors and weakly agonizes farnesoid X receptor (EC50 > 1 µM). TTNPB is used to study RAR...
| Schlagworte: | AGN 191183, Arotinoid Acid, Ro 13-7410,... |
| Anwendung: | Retinoic acid receptor agonist |
| CAS | 71441-28-6 |
| MW: | 348.5 D |
ab 60,00 €
