Zu "70458-96-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Norfloxacin
Artikelnummer: TGM-T1306-500mg
Description: Norfloxacin (MK-0366)(Norxacin) is a broad-spectrum antibiotic that is active against both Gram-positive and Gram-negative bacteria. Target: Endogenous Metabolite, DNA gyrase, Antibacterial, Topoisomerase, Antibiotic. Smiles: CCN1C=C(C(O)=O)C(=O)C2=CC(F)=C(C=C12)N1CCNCC1. References: Preissner S, et...
| Schlagworte: | MK-0366 |
| Anwendung: | Antibacterial, Nucleic acid biosynthesis inhibitor |
| CAS | 70458-96-7 |
| MW: | 319.33 D |
41,00 €
Norfloxacin
Artikelnummer: Cay25975-5
Norfloxacin is a fluoroquinolone antibiotic that inhibits the growth of Gram-positive and Gram-negative bacteria (MICs = 4 and 1 µg/ml for S. aureus and P. aeruginosa, respectively). It also inhibits the growth S. pseudintermedius, S. aureus, E. coli, Pasturella, and S. canis isolates from dogs (mean MIC50s = 0.25,...
| Schlagworte: | 1-ethyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid |
| Anwendung: | Antibacterial, Topoisomerase IV inhibitor |
| CAS | 70458-96-7 |
| MW: | 319.3 D |
ab 60,00 €
Norfloxacin
Artikelnummer: LKT-N5768.10
A fluorinated antibacterial quinolone.
| Anwendung: | Antibacterial agent |
| CAS | 70458-96-7 |
| MW: | 319,33 D |
ab 49,00 €
