Zu "69567-11-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Deoxynojirimycin Tetrabenzyl Ether
Artikelnummer: TGM-T37903-10mg
Description: Deoxynojirimycin (dNM) tetrabenzyl ether is an intermediate for the synthesis of glucosylceramide synthase inhibitors such as 1-dNM, a glucose analog that potently inhibits alpha-glucosidase I and II. Target: Others. Smiles: C(OCc1ccccc1)[C@H]1NC[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1
| Anwendung: | Alpha-glucosidase inhibitor |
| CAS | 69567-11-9 |
| MW: | 523.673 D |
ab 184,00 €
Deoxynojirimycin Tetrabenzyl Ether
Artikelnummer: Cay10011914-10
Deoxynojirimycin (dNM) tetrabenzyl ether is an intermediate for the synthesis of glucosylceramide synthase inhibitors such as 1-dNM, a glucose analog that potently inhibits alpha-glucosidase I and II.Formal Name: 3R,4R,5S-tris(phenylmethoxy-2R-[(phenylmethoxy)methyl]-piperidine. CAS Number: 69567-11-9. Synonyms: DNJ...
| Schlagworte: | dNM Tetrabenzyl Ether, 3R,4R,5S-tris(phenylmethoxy-2R-[(phenylmethoxy)methyl]-piperidine |
| Anwendung: | Alpha-glucosidase inhibitor |
| CAS | 69567-11-9 |
| MW: | 523.7 D |
ab 102,00 €
