Zu "6893-02-3" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Liothyronine
Artikelnummer: TGM-T1653-100mg
Description: Liothyronine (Tresitope) is an active form of thyroid hormone, binding to beta1 thyroid hormone receptor (TRbeta1), and activates its activity. Target: Endogenous Metabolite, Thyroid hormone receptor(THR). Smiles: N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(O)=O. References: Zhou X, et al. Repositioning...
| Schlagworte: | L-3,3',5-Triiodothyronine, Triiodothyronine, Lyothyronine, 3,3',5-Triiodo-L-thyronine,... |
| Anwendung: | Thyroid hormone |
| CAS | 6893-02-3 |
| MW: | 650.97 D |
ab 36,00 €
3,3',5-Triiodo-L-thyronine
Artikelnummer: Cay30996-1
3,3',5-Triiodo-L-thyronine (T3) is a thyroid hormone. It is produced by 5'-monodeiodination of the prohormone thyroxine (T4) in various tissues, including liver and kidney. T3 is an agonist of thyroid hormone receptors TRalpha and TRbeta (Kis = 2.3 nM for both) that modulates diverse biological properties, including...
| Schlagworte: | L-3,3',5-Triiodothyronine, Liothyronine, NSC 80203, T3, O-(4-hydroxy-3-iodophenyl)-3,5-diiodo-L-tyrosine |
| Anwendung: | Thyroid hormone |
| CAS | 6893-02-3 |
| MW: | 651 D |
ab 100,00 €
Triiodothyronine
Artikelnummer: ISO-S8165UNL.100
| Schlagworte: | unlabelled |
| Anwendung: | Thyroid hormone receptor, alpha agonist, Thyroid hormone receptor, beta agonist |
| CAS | 6893-02-3 |
| MW: | 651 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Triiodothyronine
Artikelnummer: ISO-8165UNL.1
| Schlagworte: | unlabelled, L-Liothyronine, T3 |
| Anwendung: | Thyroid hormone receptor, alpha agonist, Thyroid hormone receptor, beta agonist |
| CAS | 6893-02-3 |
| MW: | 651 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
