Zu "68683-34-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Bilirubin Conjugate (sodium salt)
Artikelnummer: TGM-T35980-100mg
Description: Bilirubin conjugate is a stable, water-soluble ditaurate derivative of bilirubin meant to mimic endogenous bilirubin glucuronide derivatives. Target: Others. Smiles: [Na].[Na].CC1=C(CCC(=O)NCCS(O)(=O)=O)C(Cc2[nH]c(C=C3NC(=O)C(C=C)=C3C)c(C)c2CCC(=O)NCCS(O)(=O)=O)NC1=CC1=NC(=O)C(C)=C1C=C ,...
| CAS | 68683-34-1 |
| MW: | 844.91 D |
ab 93,00 €
Bilirubin Conjugate (sodium salt)
Artikelnummer: Cay17170-10
Bilirubin conjugate is a stable, water-soluble ditaurate derivative of bilirubin (Cay-17161) meant to mimic endogenous bilirubin glucuronide derivatives. In vivo, bilirubin circulates in the plasma and is taken up by hepatocytes and conjugated to one or two glucuronic acids in a reaction catalyzed by UDP...
| Schlagworte: | Bilirubin Ditaurate,... |
| Anwendung: | Stable, water-soluble bilirubin ditaurate derivative, antioxidant |
| CAS | 68683-34-1 |
| MW: | 842.9 D |
ab 52,00 €
