Zu "68112-21-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Elasnin
Artikelnummer: TGM-T27251-5mg
Description: Elasnin is a reversible inhibitor of elastase for human granulocyte and pancreatic enzymes with IC50 values of 1.3 and 30 µg/ml, respectively. Target: Others. Smiles: CCCCCC(=O)C(CCCC)c1oc(=O)c(CCCC)c(O)c1CCCC. References: Cook L, Ternai B, Ghosh P. Inhibition of human sputum elastase by substituted...
| Anwendung: | Leukocyte elastase inhibitor |
| CAS | 68112-21-0 |
| MW: | 392.57 D |
958,00 €
Elasnin
Artikelnummer: Cay21481-5
Elasnin is a product isolated from certain strains of Streptomyces that acts as a reversible inhibitor of elastase with IC50 values of 1.3 and 30 µg/ml for human granulocyte and pancreatic enzymes, respectively. It inhibits human leukocyte elastase, porcine pancreatic elastase, and chymotrypsin with Ki values of 93,...
| Schlagworte: | 3,5-dibutyl-6-(1-butyl-2-oxoheptyl)-4-hydroxy-2H-pyran-2-one |
| Anwendung: | Elastase inhibitor |
| CAS | 68112-21-0 |
| MW: | 392.6 D |
523,00 €
Elasnin
Artikelnummer: BVT-0342-M001
Inhibitor of human leukocyte elastase (IC50 = 1.3 µg/ml), different other elastases and chymotrypsin (IC50 = 82 µg/ml). Isolated from Streptomyces sp.
| Schlagworte: | 3,5-Dibutyl-4-hydroxy-6-(6-oxoundecan-5-yl)-2H-pyran-2-one |
| Anwendung: | Leukocyte elastase inhibitor |
| CAS | 68112-21-0 |
| MW: | 392,6 D |
ab 140,00 €
