Zu "677773-91-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SM-324405
Artikelnummer: TGM-T7860-100mg
Description: SM-324405 is an agonist of TLR7. Target: TLR. Smiles: CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CC(=O)OC)c3)c2n1. References: Kurimoto A, Hashimoto K, Nakamura T.Synthesis and biological evaluation of 8-oxoadenine derivatives as toll-like receptor 7 agonists introducing the antedrug concept[J].J Med Chem. 2010...
| Schlagworte: | SM 324405 |
| Anwendung: | TLR7 agonist |
| CAS | 677773-91-0 |
| MW: | 385.42 D |
ab 52,00 €
SM-324405
Artikelnummer: Cay29457-1
SM-324405 is a toll-like receptor 7 (TLR7) agonist (EC50 = 50.1 nM in a reporter assay using HEK293 cells expressing the human receptor). It is selective for TLR7 over TLR8 (EC50 = >10 µM). SM-324405 induces IFN production in isolated human peripheral blood mononuclear cells (PBMCs) with a minimum effective...
| Schlagworte: | 3-[(6-amino-2-butoxy-7,8-dihydro-8-oxo-9H-purin-9-yl)methyl]-benzeneacetic acid, methyl ester |
| Anwendung: | TLR7 agonist |
| CAS | 677773-91-0 |
| MW: | 385.4 D |
ab 50,00 €
