Zu "672-87-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Metyrosine
Artikelnummer: Cay24001-50
Metyrosine is an inhibitor of tyrosine hydroxylase. In vivo, metyrosine (200 mg/kg) reduces norepinephrine and dopamine levels in rat brain and disrupts conditioned avoidance behavior in a dose-dependent manner. Metyrosine reduces dopamine transporter knockdown-induced hyperactivity and rearing behavior and...
| Schlagworte: | L-alpha-MT, MK-781, alpha-Methyl-L-p-tyrosine, alpha-methyl-L-tyrosine |
| Anwendung: | Tyrosine hydroxylase inhibitor |
| CAS | 672-87-7 |
| MW: | 195.2 D |
ab 67,00 €
Metyrosine
Artikelnummer: TGM-T22368-100mg
Description: Metyrosine (alpha-Methyltyrosine) is an antihypertensive drug and could be used as a tyrosine hydroxylase inhibitor.Metyrosine significantly inhibits high COX-2 activity. Metyrosine is a very effective agent for blood pressure control. Target: COX. Smiles: C[C@](N)(Cc1ccc(O)cc1)C(O)=O. References: Garg...
| Schlagworte: | alpha-Methyltyrosine |
| Anwendung: | Targets tyrosine 3-monooxygenase [EC:1.14.16.2] (TH) |
| CAS | 672-87-7 |
| MW: | 195.22 D |
ab 40,00 €
