Zu "668-49-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Murideoxycholic Acid
Artikelnummer: TGM-T37997-1mg
Description: Murideoxycholic Acid alleviates non-alcoholic fatty liver disease by modulating the enterohepatic axis. Target: Endogenous Metabolite. Smiles: [H][C@@]12CC[C@H]([C@H](C)CCC(O)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C[C@@H](O)[C@]2([H])C[C@H](O)CC[C@]12C. References: Khallou J, et al. Metabolism and...
| CAS | 668-49-5 |
| MW: | 392.57 D |
397,00 €
Murideoxycholic Acid
Artikelnummer: Cay20290-1
Murideoxycholic acid (MDCA) is a secondary bile acid produced from alpha-muricholic acid (Cay-20291) and beta-muricholic acid (Cay-20287). It is also a metabolite of lithocholic acid (Cay-20253) in liver S9 fractions from humans and other species. MDCA prevents gallstone formation in hamsters fed a lithogenic diet...
| Schlagworte: | MDCA, Murocholic Acid, NSC 18166, 5beta-3alpha,6beta-dihydroxy-cholan-24-oic acid |
| Anwendung: | Secondary bile acid |
| CAS | 668-49-5 |
| MW: | 392.6 D |
ab 128,00 €
Murideoxycholic Acid
Artikelnummer: ISO-17066.1
Unlabeled
| Anwendung: | Bile acid |
| CAS | 668-49-5 |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
