Zu "658084-64-1" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(E)-Daporinad
Artikelnummer: TGM-T2644-100mg
Description: (E)-Daporinad (FK866) is a small molecule inhibitor of nicotinamide phosphoribosyltransferase (NMPRTase), offering potential antineoplastic and antiangiogenic activities. Target: Autophagy, NAMPT, Transferase. Smiles: C(=O)(N1CCC(CCCCNC(/C=C/C=2C=CC=NC2)=O)CC1)C3=CC=CC=C3. References: Nahimana A, et...
| Schlagworte: | FK866, APO866, Daporinad, (E)-N-[4-(1-BENZOYL-PIPERIDIN-4-YL)-BUTYL]-3-PYRIDIN-3-YL-ACRYLAMIDE |
| CAS | 658084-64-1 |
| MW: | 391.51 D |
ab 37,00 €
FK-866
Artikelnummer: Cay13287-5
FK-866 is a highly specific non-competitive inhibitor of Nampt (Ki = 0.4 nM), causing gradual NAD+ depletion. In HepG2 human liver carcinoma cells, NAD+ depletion by FK-866 directs delayed cell death by apoptosis (IC50 = ~1 nM). In normal human smooth muscle cells, FK-866 causes premature senescence, an effect that...
| Schlagworte: | K 22.175, N-[4-(1-benzoyl-4-piperidinyl)butyl]-3-(3-pyridinyl)-2E-propenamide |
| Anwendung: | NAMPT inhibitor |
| CAS | 658084-64-1 |
| MW: | 391.5 D |
ab 36,00 €
FK-866
Artikelnummer: AG-CR1-0011-M001
Nampt/visfatin inhibitor, Inhibitor of NAD biosynthesis, Inhibits the enzyme/substrate complex and the free enzyme (Ki = 0,4 nM and Ki = 0,3 nM, respectively), Apoptosis inducer, Autophagy inducer, Causes premature senescence, Angiogenesis inhibitor.
| Schlagworte: | K 22.175, FK866, APO866, WK175, N-[4-(1-benzoyl-4-piperidinyl)butyl]-3-(3-pyridinyl)-2E-propenamide |
| Anwendung: | Nampt/visfatin inhibitor |
| CAS | 658084-64-1 |
| MW: | 391,5 D |
ab 39,00 €
