Zu "653592-04-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MT-DADMe-ImmA
Artikelnummer: TGM-TQ0008-100mg
Description: MT-DADMe-ImmA (MTDIA) is an inhibitor of human 5'-methylthioadenosine phosphorylase (MTAP, Ki: 90 pM). Target: Others. Smiles: CSC[C@H]1CN(Cc2c[nH]c3c(N)ncnc23)C[C@@H]1O. References: Evans GB, et al. Second generation transition state analogue inhibitors of human 5'-methylthioadenosine phosphorylase. J...
| Schlagworte: | Methylthio-DADMe-Immucillin A, MTDIA |
| Anwendung: | MTAP inhibitor |
| CAS | 653592-04-2 |
| MW: | 293.39 D |
ab 63,00 €
MT-DADMe-ImmA
Artikelnummer: Cay29711-1
MT-DADMe-ImmA is an inhibitor of 5'-methylthioadenosine phosphorylase (MTAP, Ki = 1.7 nM). It increases levels of MTA (Cay-15593), a product of polyamine metabolism, in FaDu human squamous cell carcinoma cells when used at a concentration of 1 µM. MT-DADMe-ImmA (5, 9, and 21 mg/kg per day for 28 days) reduces tumor...
| Schlagworte: | Methylthio-DADMe-Immucillin A, MTDIA,... |
| Anwendung: | MTAP inhibitor |
| CAS | 653592-04-2 |
| MW: | 293.4 D |
ab 52,00 €
