Zu "6501-72-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
VGX-1027
Artikelnummer: TGM-T1813-100mg
Description: VGX-1027 (GIT 27) is an isoxazole compound with various immunomodulatory properties. Target: TNF, Interleukin, IL Receptor. Smiles: OC(=O)CC1CC(=NO1)c1ccccc1. References: Stosic-Grujicic S, et al. J Pharmacol Exp Ther. 2007, 320(3), 1038-1049.
| Schlagworte: | VGX1027, VGX 1027, GIT 27 |
| Anwendung: | Immunomodulatory agent |
| CAS | 6501-72-0 |
| MW: | 205.21 D |
ab 42,00 €
VGX-1027
Artikelnummer: LKT-V2792.10
TLR4 inhibitor.
| Schlagworte: | GIT27 |
| Anwendung: | TLR4 inhibitor |
| CAS | 6501-72-0 |
| MW: | 205.21 D |
ab 126,00 €
GIT 27
Artikelnummer: Cay16293-10
GIT 27 is an orally active, isoxazole compound that exhibits various immunomodulatory properties both in vitro and in preclinical in vivo models of autoimmune diseases by inhibiting inflammatory antigen presentation. It has been shown to target macrophages, reducing the production of the proinflammatory mediators...
| Schlagworte: | VGX-1027, 4,5-dihydro-3-phenyl-5-isoxazoleacetic acid |
| Anwendung: | Immunomodulatory agent |
| CAS | 6501-72-0 |
| MW: | 205.2 D |
ab 85,00 €
