Zu "64806-05-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Captopril disulfide
Artikelnummer: TGM-T20512-10mg
Description: Captopril disulfide, a metabolite of Captopril, is a new antihypertensive agent. Target: Others. Smiles: C([C@@H](CSSC[C@H](C(=O)N1[C@H](C(O)=O)CCC1)C)C)(=O)N2[C@H](C(O)=O)CCC2. References: Bojarska J, Maniukiewicz W, Fruzinski A, Sieron L, Remko M. Captopril and its dimer captopril disulfide:...
| Schlagworte: | SQ 14,551, SQ-14,551, SQ14,551 |
| Anwendung: | Captopril metabolite, potential impurity |
| CAS | 64806-05-9 |
| MW: | 432.56 D |
ab 289,00 €
Captopril Disulfide
Artikelnummer: Cay28018-10
Captopril disulfide is a metabolite and symmetrical disulfide form of the angiotensin converting enzyme (ACE) inhibitor captopril (Cay-15313). Captopril disulfide is the main degradation product of captopril and is formed by oxidation. It is a potential impurity in commercial preparations of captopril. Captopril...
| Schlagworte: | SQ 14551, 1,1'-[dithiobis[(2S)-2-methyl-1-oxo-3,1-propanediyl]]bis-L-proline |
| Anwendung: | Captopril metabolite, Potential impurity |
| CAS | 64806-05-9 |
| MW: | 432.6 D |
ab 163,00 €
