Zu "646995-35-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cinaciguat hydrochloride
Artikelnummer: TGM-T1984L-100mg
Description: Cinaciguat( BAY582667, BAY58-2667) is a soluble guanosine cyclase activator that can prevent cardiac dysfunction in rat models of type 1 diabetes. Target: Others. Smiles: Cl.OC(=O)CCCCN(CCc1ccccc1OCc1ccc(CCc2ccccc2)cc1)Cc1ccc(cc1)C(O)=O. References: Mátyás C, Németh BT, Oláh A, Hidi L, Birtalan E,...
| Schlagworte: | BAY 58-2667, BAY-58-2667, Cinaciguat HCl, BAY58-2667, BAY-582667, BAY 582667, BAY582667 |
| Anwendung: | Soluble guanylate cyclase activator |
| CAS | 646995-35-9 |
| MW: | 602.17 D |
ab 112,00 €
Cinaciguat (hydrochloride)
Artikelnummer: Cay17468-1
Soluble guanylate cyclase (sGC) is the primary cellular receptor for NO. NO binds and activates a heme group in sGC, initiating the conversion of GTP to the second messenger cGMP. cGMP subsequently mediates a number of signaling cascades leading to vasorelaxation and inhibiting smooth muscle proliferation, leukocyte...
| Schlagworte: | BAY 58-2667, 4-[[(4-carboxybutyl)[2-[2-[[4-(2-phenylethyl)phenyl]methoxy]phenyl]ethyl]amino]methyl]-benzoic acid,... |
| Anwendung: | Soluble guanylate cyclase activator |
| CAS | 646995-35-9 |
| MW: | 602.2 D |
ab 78,00 €
