Zu "64302-87-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
R162
Artikelnummer: TGM-T4173-100mg
Description: R162 is an effective glutamate dehydrogenase 1 (GDH1) inhibitor. Target: Dehydrogenase. Smiles: Oc1c(CC=C)ccc2C(=O)c3ccccc3C(=O)c12. References: Jin L, et al. Glutamate dehydrogenase 1 signals through antioxidant glutathione peroxidase 1 to regulate redox homeostasis and tumor growth. Cancer Cell. 2015...
| Anwendung: | GDH1 inhibitor |
| CAS | 64302-87-0 |
| MW: | 264.28 D |
ab 34,00 €
R162
Artikelnummer: Cay30922-10
R162 is an inhibitor of glutamate dehydrogenase 1 (GDH1, IC50 = 23 µM). It decreases intracellular fumarate levels and increases the production of mitochondrial reactive oxygen species (ROS) in human H1299 lung and MDA-MB-231 breast cancer cells. R162 (10-40 µM) inhibits proliferation in a panel of human cancer cell...
| Schlagworte: | 1-hydroxy-2-(2-propen-1-yl)-9,10-anthracenedione |
| Anwendung: | GDH1 inhibitor |
| CAS | 64302-87-0 |
| MW: | 264.3 D |
ab 70,00 €
