Zu "64232-83-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
L189
Artikelnummer: TGM-T4517-100mg
Description: L189 is a human DNA ligase inhibitor, inhibits hLigI/III/IV (IC50: 5/9/5 µM). Target: DNA/RNA Synthesis, DNA. Smiles: Nc1[nH]c(=S)[nH]c(=O)c1N=Cc1ccccc1. References: Xi Chen, et al. Rational Design of Human DNA Ligase Inhibitors that Target Cellular DNA Replication and Repair. Cancer Res 2008, 68: (9)....
| Anwendung: | DNA ligase I, III, IV inhibitor |
| CAS | 64232-83-3 |
| MW: | 246.29 D |
ab 37,00 €
L189
Artikelnummer: Cay18374-10
L189 is a competitive inhibitor of DNA ligases I, III, and IV (IC50s = 5, 9, and 5 µM, respectively). It blocks DNA binding (Ki = 5 µM for DNA ligase I), increasing the cytotoxicity of DNA-damaging agents, including ionizing radiation. L189 preferentially inhibits the interaction of the ligase with damaged DNA,...
| Schlagworte: | 6-amino-2,3-dihydro-5-[(phenylmethylene)amino]-2-thioxo-4(1H)-pyrimidinone |
| Anwendung: | DNA ligase I, III, IV inhibitor |
| CAS | 64232-83-3 |
| MW: | 246.3 D |
ab 117,00 €
