Zu "63631-40-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
BW-180C
Artikelnummer: TGM-TP1905-100mg
Description: BW-180C (DADLE) is a prototypical delta-opioid receptor agonist that also displays activity at the µ-opioid receptor. Displays antinociceptive activity in vivo. Target: Opioid Receptor. Smiles: [C@H](CC1=CC=CC=C1)(C(N[C@H](CC(C)C)C(O)=O)=O)NC(CNC([C@H](NC([C@H](CC2=CC=C(O)C=C2)N)=O)C)=O)=O. References:...
| Schlagworte: | DADLE |
| Anwendung: | Delta-type opioid receptor peptide agonist |
| CAS | 63631-40-3 |
| MW: | 569.65 D |
ab 40,00 €
DADLE
Artikelnummer: Cay28928-1
DADLE is a peptide agonist of delta-opioid receptors (Ki = 2.06 nM in a radioligand binding assay). It is selective for delta-opioid over kappa-opioid receptors (Ki = 16,000 nM) but also agonizes µ-opioid receptors (Ki = 13.8 nM). DADLE inhibits electrically induced contractions in guinea pig myenteric plexus and...
| Schlagworte: | [D-Ala2, D-Leu5]-Enkephalin, L-tyrosyl-D-alanylglycyl-L-phenylalanyl-D-leucine |
| Anwendung: | Delta-type opioid receptor peptide agonist |
| CAS | 63631-40-3 |
| MW: | 569.7 D |
ab 44,00 €
