Zu "635701-59-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CAY10734
Artikelnummer: TGM-T38371-10mg
Description: CAY10734 has a wide range of applications in life science related research. Target: Others. Smiles: CC(C)Cc1ccc(cc1)-c1nc(no1)-c1ccc(CN2CC(C2)C(O)=O)cc1
| Anwendung: | S1P1 receptor agonist |
| CAS | 635701-59-6 |
| MW: | 391.471 D |
ab 77,00 €
CAY10734
Artikelnummer: Cay10007833-1
CAY10734 is an agonist of sphingosine-1-phosphate receptor 1 (S1P1, IC50 = 0.6 nM). It selectively binds S1P1 over S1P2, S1P3, and S1P4 receptors (IC50s = >10,000, 12,000, and 70 nM, respectively) but does also bind S1P5 receptors (IC50 = 1 nM) in radioligand binding assays. CAY10734 reduces the number of peripheral...
| Schlagworte: | 1-[[4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]-3-azetidinecarboxylic acid |
| Anwendung: | S1P1 receptor agonist |
| CAS | 635701-59-6 |
| MW: | 391.5 D |
ab 43,00 €
