Zu "630124-46-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AST 487
Artikelnummer: TGM-T4053-100mg
Description: AST 487 (NVP-AST 487) is a RET kinase inhibitor, inhibiting RET autophosphorylation and activation of downstream effectors. It also can inhibit Flt-3. Target: VEGFR, c-Kit, FLT, c-RET, Bcr-Abl. Smiles: C(C1=C(C(F)(F)F)C=C(NC(NC2=CC=C(OC=3C=C(NC)N=CN3)C=C2)=O)C=C1)N4CCN(CC)CC4. References:...
| Schlagworte: | NVP-AST 487 |
| Anwendung: | RET inhibitor |
| CAS | 630124-46-8 |
| MW: | 529.56 D |
ab 32,00 €
AST-487
Artikelnummer: Cay19477-5
AST-487 is an inhibitor of RET (IC50 = 0.88 µM), FLT3 (Ki = 0.52 µM), KDR (IC50 = 0.17 µM), c-Abl (IC50 = 0.02 µM), and c-Kit (IC50 = 0.5 µM). It has been shown to inhibit RET autophosphorylation and activation of downstream effectors and to prevent the growth of human thyroid cancer cell lines with activating...
| Schlagworte: | NVP-AST-487,... |
| Anwendung: | Flt3 / KDR / c-Abl / c-Kit / RET inhibitor |
| CAS | 630124-46-8 |
| MW: | 529.6 D |
ab 44,00 €
AST-487
Artikelnummer: AG-CR1-3745-M001
White to off-white solid. Soluble in DMSO, DMF or ethanol. Chemical. CAS: 630124-46-8. Formula: C26H30F3N7O2. MW: 529.6. AST487 is an inhibitor of RET (IC50 = 0.88µM), FLT3 (Ki = 0.52µM), KDR (IC50 = 0.17µM), c-Abl (IC50 = 0.02µM) and c-Kit (IC50 = 0.5µM). AST-487 has been shown to inhibit RET autophosphorylation...
| Schlagworte: | AST487, NVP-AST-487 |
| Anwendung: | RET inhibitor |
| CAS | 630124-46-8 |
| MW: | 529,6 D |
ab 28,00 €
