Zu "63-37-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cytidine 5'-monophosphate
Artikelnummer: TGM-TMO2752-1g
Description: Cytidine 5'-monophosphate (5'-Cytidylic acid) is a nucleotide integral to RNA, comprising the nucleobase cytosine, pentose ribose, and phosphate groups. Target: Others, Endogenous Metabolite. Smiles: Nc1ccn([C@@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]2O)c(=O)n1. References: Parrou, J., et al.: Anal....
| Schlagworte: | Cytidylic Acid, 5'-Cytidylic acid, 5'-CMP |
| CAS | 63-37-6 |
| MW: | 323.2 D |
ab 31,00 €
Cytidine 5'-monophosphate
Artikelnummer: Cay35116-1
Cytidine 5'-monophosphate (CMP) is a pyrimidine nucleotide. It is used in the synthesis of RNA and can be further phosphorylated to form cytidine 5'-diphosphate (CDP) and cytidine 5'-triphosphate (CTP). CMP is also an intermediate in the synthesis of phospholipids.Formal Name: 5'-cytidylic acid. CAS Number: 63-37-6....
| Schlagworte: | 5'-CMP, CMP, Cytidine 5'-phosphate, 5'-cytidylic acid |
| Anwendung: | Pyrimidine nucleotide |
| CAS | 63-37-6 |
| MW: | 323.2 D |
ab 61,00 €
