Zu "61278-30-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D-Saccharic acid 1,4-lactone hydrate
Artikelnummer: TGM-T41319-10mg
Description: D-Saccharic acid 1,4-lactone hydrate is a potent beta-glucuronidase inhibitor (IC50=48.4 µM) that possesses anticarcinogenic, detoxifying, and antioxidant properties[1][2]. Target: Others. Smiles: O.O[C@@H]([C@H]1OC(=O)[C@H](O)[C@H]1O)C(O)=O. References: Taha M, et al. Synthesis, beta-glucuronidase...
| Anwendung: | beta-glucuronidase inhibitor |
| CAS | 61278-30-6 |
| MW: | 317.81 D |
ab 31,00 €
D-Saccharic Acid 1,4-lactone (hydrate)
Artikelnummer: Cay18896-250
D-Saccharic acid 1,4-lactone is an inhibitor of beta-glucuronidase (IC50 = 45 µM for the human enzyme). It is commonly used as a standard in the development of novel inhibitors of beta-glucuronidase. D-Saccharic acid 1,4-lactone is also used to prevent the cleavage of glucuronides in plasma, serum, or urine by...
| Schlagworte: | D-Glucaro-1,4-lactone, 1,4-lactone D-glucaric acid, monohydrate |
| Anwendung: | beta-glucuronidase inhibitor |
| CAS | 61278-30-6 |
| MW: | 210.1 D |
ab 44,00 €
