Zu "612487-72-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AZD1080
Artikelnummer: TGM-T1741-100mg
Description: AZD1080 is a selective, orally active, brain permeable GSK3 inhibitor. Target: GSK-3. Smiles: Oc1[nH]c2ccc(cc2c1-c1ccc(CN2CCOCC2)cn1)C#N. References: Georgievska B, et al. J Neurochem, 2013, 125(3), 446-456.
| Anwendung: | Brain permeable GSK3alpha/beta inhibitor |
| CAS | 612487-72-6 |
| MW: | 334.37 D |
ab 37,00 €
AZD 1080
Artikelnummer: Cay16676-1
The two isoforms of glycogen synthase kinase 3, GSK3alpha and GSK3beta, constitutively phosphorylate and inactivate glycogen synthase, preventing glycogen synthesis. They also phosphorylate proteins that are relevant to Alzheimer's disease and osteogenesis. AZD 1080 is a potent, brain permeable inhibitor of...
| Schlagworte: | 2-hydroxy-3-[5-(4-morpholinylmethyl)-2-pyridinyl]-1H-indole-5-carbonitrile |
| Anwendung: | Brain permeable GSK3alpha/beta inhibitor |
| CAS | 612487-72-6 |
| MW: | 334.4 D |
ab 39,00 €
