Zu "611168-24-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Glycerol phenylbutyrate
Artikelnummer: TGM-T15393-100mg
Description: Glycerol phenylbutyrate (HPN-100) (GPB) is a new generation ammonia scavenger drug and it also is a sigma-2 (sigma2) receptor ligand (pKi: 8.02). Target: Sigma receptor. Smiles: O=C(CCCc1ccccc1)OCC(COC(=O)CCCc1ccccc1)OC(=O)CCCc1ccccc1. References: Rescifina A, et al. Development of a Sigma-2 Receptor...
| Schlagworte: | HPN-100 |
| Anwendung: | Urea cycle disorder agent, Nitrogen binding agent |
| CAS | 611168-24-2 |
| MW: | 530.65 D |
ab 40,00 €
Glycerol Phenylbutyrate
Artikelnummer: Cay40832-10
Glycerol phenylbutyrate is a pre-prodrug form of the nitrogen-binding prodrug and chemical chaperone sodium 4-phenylbutyrate (Cay-11323). It is converted by pancreatic lipase in the small intestine to sodium 4-phenylbutyrate, which is subsequently converted into the active metabolite phenylacetate via...
| Schlagworte: | GPB, HPN-100, benzenebutanoic acid, 1,1',1''-(1,2,3-propanetriyl) ester |
| Anwendung: | Sodium 4-phenylbutyrate pre-prodrug form |
| CAS | 611168-24-2 |
| MW: | 530.7 D |
ab 35,00 €
