Zu "6090-95-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Conduritol B epoxide
Artikelnummer: TGM-TQ0300-100mg
Description: Conduritol B epoxide is an irreversible inhibitor of beta-glucosidase (GCase). Target: Glucosidase. Smiles: O[C@H]1[C@H]2O[C@H]2[C@H](O)[C@@H](O)[C@@H]1O. References: Liou B, et al. Modulating ryanodine receptors with dantrolene attenuates neuronopathic phenotype in Gaucher disease mice. Hum Mol Genet....
| Anwendung: | Irreversible glucocerebrosidase inhibitor |
| CAS | 6090-95-5 |
| MW: | 162.14 D |
ab 41,00 €
Conduritol B epoxide
Artikelnummer: Cay15216-5
Conduritol B epoxide (CBE) is an irreversible inhibitor of glucocerebrosidase, also known as acid beta-glucosidase, glucosylceramidase, GBA, or GBA1 (IC50 = 9 µM). Inhibition of this lysosomal glucosidase results in the accumulation of glucocerebroside without affecting cell viability, lysosomal enzyme release, or...
| Schlagworte: | CBE, 1,2-anhydro-myo-inositol |
| Anwendung: | Irreversible glucocerebrosidase inhibitor |
| CAS | 6090-95-5 |
| MW: | 162.1 D |
ab 73,00 €
