Zu "608-66-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dulcite
Artikelnummer: TGM-T0529-100mg
Description: Dulcite (D-Galactitol) is a sugar alcohol that is a metabolic breakdown product of galactose. Target: Endogenous Metabolite. Smiles: [C@H]([C@H]([C@@H](CO)O)O)([C@H](CO)O)O. References: Jeon BS, et al. Enzyme Microb Technol. 2013 Aug 15,53(3):143-51.
| Schlagworte: | NSC 1944, Melampyrit, D-Galactitol, Galactitol, Dulcitol, Euonymit |
| CAS | 608-66-2 |
| MW: | 182.17 D |
ab 31,00 €
Galactitol
Artikelnummer: Cay25023-100
Galactitol is a reduced form of galactose (Cay-20890) that has been found in various plants, including C. aculeatus. It is a toxic metabolite of galactose in humans that accumulates in the lens of patients with galactokinase deficiency-induced galactosemia, leading to cataract formation. Galactitol also accumulates...
| Schlagworte: | Dulcitol, NSC 1944, Galactitol |
| Anwendung: | Toxic galactose metabolite |
| CAS | 608-66-2 |
| MW: | 182.2 D |
ab 52,00 €
