Zu "60514-48-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1,2-Dioctanoyl-sn-glycerol
Artikelnummer: Cay62225-50
1,2-Dioctanoyl-sn-glycerol is a cell permeable analog of the PKC-activating second messenger DAG. 1,2-Dioctanoyl-sn-glycerol and 1,2-dioleoyl-sn-glycerol are nearly equipotent in induction of the acrosome reaction in human sperm.Formal Name: 1,2-bis(O-octanoyl)-sn-glycerol. CAS Number: 60514-48-9. Molecular Formula:...
| Schlagworte: | 1,2-bis(O-octanoyl)-sn-glycerol |
| Anwendung: | Bioactive lipid assays |
| CAS | 60514-48-9 |
| MW: | 344.5 D |
ab 66,00 €
1,2-Dioctanoyl-sn-glycerol
Artikelnummer: TGM-T84615-10mg
Description: ZKN14489, also known as 08:0 DG and 1,2-dioctanoyl-sn-glycerol, is a short-chain, cell-permeable diacylglycerol that serves as a lipid cofactor for activating protein kinase C. Target: Others. Smiles: CCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCC
| Schlagworte: | ZKN14489, ZKN 14489, 08:0 DG, 1,2-dioctanoyl-sn-glycerol, ZKN-14489 |
| CAS | 60514-48-9 |
| MW: | 344.492 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
