Zu "603139-19-1" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Odanacatib
Artikelnummer: TGM-T6035-100mg
Description: Odanacatib is an inhibitor of cathepsin K with potential anti-osteoporotic activity. Target: Cysteine Protease. Smiles: CC(C)(F)C[C@H](N[C@@H](c1ccc(cc1)-c1ccc(cc1)S(C)(=O)=O)C(F)(F)F)C(=O)NC1(CC1)C#N. References: Gauthier JY, et al. Bioorg Med Chem Lett. 2008, 18(3), 923-928.
| Schlagworte: | MK-0822 |
| Anwendung: | Targets cathepsin K [EC:3.4.22.38] (CTSK) |
| CAS | 603139-19-1 |
| MW: | 525.56 D |
ab 45,00 €
Odanacatib
Artikelnummer: LKT-O1200.1
Cathepsin K inhibitor.
| Schlagworte: | MK0822 |
| Anwendung: | Cathepsin K inhibitor |
| CAS | 603139-19-1 |
| MW: | 525.56 D |
ab 198,00 €
Odanacatib
Artikelnummer: Cay21466-1
Odanacatib is a potent, selective, and neutral inhibitor of cathepsin K (IC50s = 0.2 and 1 nM for human and rabbit enzymes, respectively), a protease involved in osteoclastic bone resorption. It demonstrates high selectivity for cathepsin K over cathepsins B, L, and S. Formulations containing odanacatib reduce bone...
| Schlagworte: | MK-0822,... |
| Anwendung: | Cathepsin K inhibitor |
| CAS | 603139-19-1 |
| MW: | 525.6 D |
ab 78,00 €
