Zu "60207-90-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Propiconazole
Artikelnummer: TGM-T20595-10mg
Description: Propiconazole is an agricultural pesticide. Target: Others. Smiles: CCCC1COC(Cn2cncn2)(O1)c1ccc(Cl)cc1Cl. References: Mazur CS, Marchitti SA, Zastre J. P-glycoprotein inhibition by the agricultural pesticide propiconazole and its hydroxylated metabolites: Implications for pesticide-drug interactions....
| Schlagworte: | CGA-64250, CGA64250, Desmel, CGA 64250 |
| Anwendung: | Broad-spectrum triazole fungicide |
| CAS | 60207-90-1 |
| MW: | 342.22 D |
39,00 €
Propiconazole
Artikelnummer: Cay18853-100
Propiconazole is a broad-spectrum triazole fungicide that inhibits the conversion of lanosterol to ergosterol, leading to fungal cell membrane disruption. It inhibits S. cerevisiae, but not rat liver, microsomal cytochrome P450 (IC50s = 0.04 and >200 µM, respectively). Propiconazole inhibits the growth of T....
| Schlagworte: | CGA 64250, 1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1H-1,2,4-triazole |
| Anwendung: | Broad-spectrum triazole fungicide |
| CAS | 60207-90-1 |
| MW: | 342.2 D |
43,00 €
