Zu "600177-94-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
trans-hydroxy Glimepiride
Artikelnummer: TGM-T35641-1mg
Description: trans-Hydroxy Glimepiride is an active metabolite of the sulfonylurea glimepiride, formed primarily in the liver by the cytochrome P450 (CYP) isoform CYP2C9. Target: Others. Smiles: CCC1=C(C)CN(C(=O)NCCc2ccc(cc2)S(=O)(=O)NC(=O)N[C@H]2CC[C@H](CO)CC2)C1=O ,...
| Anwendung: | Glimepiride active metabolite |
| CAS | 600177-94-4 |
| MW: | 506.62 D |
822,00 €
trans-hydroxy Glimepiride
Artikelnummer: Cay34278-1
trans-hydroxy Glimepiride is an active metabolite of the sulfonylurea glimepiride (Cay-12090). It is formed from glimepiride primarily in the liver by the cytochrome P450 (CYP) isoform CYP2C9.Formal Name:...
| Schlagworte: | 3-ethyl-2,5-dihydro-N-[2-[4-[[[[[trans-4-(hydroxymethyl)cyclohexyl]amino]carbonyl]amino]sulfonyl]phenyl]ethyl]-4-methyl-2-... |
| Anwendung: | Glimepiride active metabolite |
| CAS | 600177-94-4 |
| MW: | 506.6 D |
449,00 €
