Zu "587841-73-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ZCL278
Artikelnummer: TGM-T1855-100mg
Description: ZCL278 is a selective Cdc42 GTPase inhibitor. Target: CDK, Ras. Smiles: Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)COc3ccc(Br)cc3Cl)cc2)n1. References: Friesland A, et al. Proc Natl Acad Sci U S A. 2013, 110(4), 1261-1266.
| Schlagworte: | ZCL 278 |
| Anwendung: | Cdc42 inhibitor |
| CAS | 587841-73-4 |
| MW: | 584.89 D |
ab 46,00 €
ZCL 278
Artikelnummer: Cay14849-5
ZCL 278 is a cell-permeable inhibitor of Cdc42, a Rho family GTPase. It binds into the surface groove on Cdc42 (Kd = 6.4-11.4 µM), blocking interaction with intersectin (ITSN), a guanine nucleotide exchange factor (GEF). It inhibits Cdc42-mediated microspike formation and neuronal branching in 3T3 fibroblast and...
| Schlagworte: | 2-(4-bromo-2-chlorophenoxy)-N-[[[4-[[(4,6-dimethyl-2-pyrimidinyl)amino]sulfonyl]phenyl]amino]thioxomethyl]-acetamide |
| Anwendung: | Cdc42 inhibitor |
| CAS | 587841-73-4 |
| MW: | 584.9 D |
ab 65,00 €
ZCL-278
Artikelnummer: LKT-Z0944.10
Cdc42 inhibitor.
| Schlagworte: | ZCL278 |
| Anwendung: | Cdc42 inhibitor |
| CAS | 587841-73-4 |
| MW: | 584.89 D |
ab 125,00 €
