Zu "574759-62-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
VAF347
Artikelnummer: TGM-T13276-100mg
Description: VAF347 is a cell-permeable and highly affinity agonist of the aryl hydrocarbon receptor (AhR) with anti-inflammatory effects. Target: Aryl Hydrocarbon Receptor. Smiles: FC(F)(F)c1ccc(Nc2nccc(n2)-c2cccc(Cl)c2)cc1. References: Ibabao CN, et al. The AhR agonist VAF347 augments retinoic acid-induced...
| Anwendung: | AhR agonist |
| CAS | 574759-62-9 |
| MW: | 349.74 D |
ab 34,00 €
VAF347
Artikelnummer: Cay37328-1
VAF347 is an agonist of the aryl hydrocarbon receptor (AhR). It binds to AhR in a radioligand binding assay using guinea pig hepatic cytosol and induces mRNA expression of the AhR target gene CYP1A1 in isolated human peripheral blood mononuclear cells (PBMCs) when used at a concentration of 50 nM. VAF347 (20 µM)...
| Schlagworte: | 4-(3-chlorophenyl)-N-[4-(trifluoromethyl)phenyl]-2-pyrimidinamine |
| Anwendung: | AhR agonist |
| CAS | 574759-62-9 |
| MW: | 349.7 D |
ab 35,00 €
