Zu "57-91-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Alpha-Estradiol
Artikelnummer: TGM-T3378-100mg
Description: Alpha-Estradiol (Epiestradiol) is an estrogen that inhibits 5alpha-reductase and has potential in the study of androgenetic alopecia. Target: Endogenous Metabolite, Reductase, Estrogen/progestogen Receptor. Smiles: C[C@@]12[C@]([C@]3([C@@](C=4C(CC3)=CC(O)=CC4)(CC1)[H])[H])(CC[C@H]2O)[H]. References:...
| Schlagworte: | Epiestrol, 17alpha-Estradiol, Alfatradiol, Epiestradiol |
| Anwendung: | Targets 3-oxo-5-alpha-steroid 4-dehydrogenase 1 [EC:1.3.1.22] (SRD5A1) |
| CAS | 57-91-0 |
| MW: | 272.38 D |
ab 50,00 €
17alpha-Estradiol
Artikelnummer: Cay20776-100
17alpha-Estradiol is the natural optical isomer of 17beta-estradiol (Cay-10006315), the major estrogen secreted by the premenopausal ovary. 17alpha-Estradiol is a less active isomer than its counterpart, displaying 100-fold lower estrogenic activity relative to 17beta-estradiol. It can inhibit 5alpha-reductase,...
| Schlagworte: | 17-epi Estradiol, 17alpha-Oestradiol, Alfatradiol, NSC 20293, alpha-Estradiol, (17alpha)-estra-1,3,5(10)-triene-3,17-diol |
| CAS | 57-91-0 |
| MW: | 272.4 D |
ab 54,00 €
