Zu "568-80-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Galloflavin
Artikelnummer: Cay14846-5
Galloflavin is an inhibitor of both the A and B isoforms of lactate dehydrogenase (Kis = 5.46 and 15.06 µM, respectively). It has been shown to prevent proliferation of many different cancer cell lines in vitro by blocking glycolysis and ATP production.Formal Name:...
| Schlagworte: | NSC 107022, 3,8,9,10-tetrahydroxy-pyrano[3,2-c][2]benzopyran-2,6-dione |
| Anwendung: | LDH inhibitor |
| CAS | 568-80-9 |
| MW: | 278.2 D |
ab 52,00 €
Galloflavin
Artikelnummer: TGM-T22336-100mg
Description: Galloflavin inhibits both the A and B isoforms of lactate dehydrogenase with Ki of 5.46 µM and 15.06 µM, respectively. Galloflavin is also a potential anticancer agent. Target: Dehydrogenase. Smiles: Oc1cc2c(c(O)c1O)c1oc(=O)c(O)cc1oc2=O. References: Manerba M, Vettraino M, Fiume L, Di Stefano G, Sartini...
| Anwendung: | LDH inhibitor |
| CAS | 568-80-9 |
| MW: | 278.17 D |
ab 37,00 €
