Zu "566-26-7" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
7alpha-Hydroxycholesterol
Artikelnummer: TGM-T19161-10mg
Description: 7alpha-Hydroxycholesterol, a cholesterol oxide formed through both enzymatic and non-enzymatic oxidation, can serve as a biomarker for lipid peroxidation. Target: Others. Smiles: [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C. References: Ferderbar...
| Anwendung: | Bile acid precursor |
| CAS | 566-26-7 |
| MW: | 402.65 D |
ab 42,00 €
7alpha-hydroxy Cholesterol
Artikelnummer: Cay20098-10
7alpha-hydroxy Cholesterol is an oxysterol and a precursor in the biosynthesis of the bile acids cholic acid (CA, Cay-20250) and chenodeoxycholic acid (CDCA, Cay-10011286). It is formed via the oxidation of cholesterol (Cay-9003100) by cholesterol 7alpha-hydroxylase/CYP7A1 in rat liver microsomes. 7alpha-hydroxy...
| Schlagworte: | cholest-5-ene-3beta,7alpha-diol |
| CAS | 566-26-7 |
| MW: | 402.7 D |
ab 61,00 €
7alpha-Hydroxycholesterol
Artikelnummer: ISO-13410.1
Unlabeled
| Schlagworte: | unlabelled |
| Anwendung: | Steroid |
| CAS | 566-26-7 |
| MW: | 403 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
7alpha-Hydroxycholesterol
Artikelnummer: ISO-S13410.100
| Schlagworte: | unlabelled |
| CAS | 566-26-7 |
| MW: | 403 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
