Zu "56396-35-1" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
UK-5099
Artikelnummer: TGM-T4441-100mg
Description: UK-5099 (PF-1005023) is a specific and potent inhibitor of MPC carrier activity, effectively inhibiting pyruvate-dependent oxygen consumption in rat heart mitochondria with an IC50 of 50 nM [1]. Target: Others, Mitochondrial Metabolism. Smiles: OC(=O)C(=Cc1cn(-c2ccccc2)c2ccccc12)C#N. References:...
| Schlagworte: | UK5099, UK 5099, PF-1005023 |
| Anwendung: | Potent, specific mitochondrial pyruvate carrier inhibitor |
| CAS | 56396-35-1 |
| MW: | 288.3 D |
ab 31,00 €
UK 5099
Artikelnummer: Cay16980-5
UK 5099 is a potent inhibitor of the mitochondrial pyruvate carrier (MPC) that inhibits pyruvate-dependent oxygen consumption by rat heart mitochondria (IC50 = 50 nM). It decreases glucose flux to the TCA cycle and increases production of M6 citrate via glutaminolytic flux through malic enzymes without affecting...
| Schlagworte: | 2-cyano-3-(1-phenyl-1H-indol-3-yl)-2-propenoic acid |
| Anwendung: | MPC1 / MPC2 inhibitor |
| CAS | 56396-35-1 |
| MW: | 288.3 D |
ab 44,00 €
UK 5099
Artikelnummer: AG-CR1-3691-M001
Potent and specific inhibitor of the mitochondrial pyruvate carrier (MPC), blocking pyruvate from entering the mitochondria, consequently promoting lactate production. Inhibitor of tricarboxylic acid (TCA) cycle. Plasma membrane monocarboxylate transporters (MCTs) inhibitor, but with Ki values some two or three...
| Schlagworte: | PF-1005023, 2-Cyano-3-(1-phenyl-1H-indol-3-yl)-2-propenoic acid |
| Anwendung: | Potent, specific mitochondrial pyruvate carrier inhibitor |
| CAS | 56396-35-1 |
| MW: | 288.3 D |
ab 39,00 €
