Zu "56038-13-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Sucralose
Artikelnummer: TGM-T1399-10g
Description: Sucralose is a non-nutritive artificial sweetener and sugar substitute that stimulates appetite in rodents by activating a conserved neural fasting response. Target: Endogenous Metabolite, Others. Smiles: O([C@]1(CCl)O[C@H](CCl)[C@@H](O)[C@@H]1O)[C@H]2O[C@H](CO)[C@H](Cl)[C@H](O)[C@H]2O. References:...
| Schlagworte: | Trichlorosucrose, E955 |
| CAS | 56038-13-2 |
| MW: | 397.63 D |
ab 30,00 €
Sucralose
Artikelnummer: Cay31621-25
Sucralose is a synthetic disaccharide and non-caloric sweetener. It is not readily metabolized in humans and has been found as a contaminant in wastewater. Formulations containing sucralose reduce Bifidobacterium, Lactobacillus, Bacteroides, and Clostridium bacterial counts in the gastrointestinal tract and increase...
| Schlagworte: | 1,6-dichloro-1,6-dideoxy-beta-D-fructofuranosyl 4-chloro-4-deoxy-alpha-D-galactopyranoside |
| Anwendung: | Synthetic disaccharide, non-caloric sweetener |
| CAS | 56038-13-2 |
| MW: | 397.6 D |
ab 44,00 €
