Zu "55661-38-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Nimustine Hydrochloride
Artikelnummer: TGM-T5017-5mg
Description: Nimustine Hydrochloride (Nidran hydrochloride) has been used in trials studying the treatment of Glioblastoma. Target: Apoptosis, DNA/RNA Synthesis, Others, DNA Alkylator/Crosslinker. Smiles: Cl.Cc1ncc(CNC(=O)N(CCCl)N=O)c(N)n1. References: Matsumoto, T. et al.: J. Eur. Acad. Dermatol. Venereol., 27,...
| Schlagworte: | Nidran hydrochloride |
| Anwendung: | Antineoplastic, Alkylating agent |
| CAS | 55661-38-6 |
| MW: | 309.15 D |
ab 45,00 €
Nimustine hydrochloride
Artikelnummer: LKT-N3452.1
DNA cross-linker used to treat malignant glioma.
| Anwendung: | Cancer studies |
| CAS | 55661-38-6 |
| MW: | 309,16 D |
ab 85,00 €
Nimustine (hydrochloride)
Artikelnummer: Cay31464-1
Nimustine is a pyrimidine analog and nitrosourea alkylating agent with anticancer activity. It inhibits the growth of U-251MG and EA285 glioma cells when used at a concentration of 10 µg/ml. Nimustine (30 mg/kg) increases the median survival time in a Walker 256 carcinoma rat model of metastatic brain tumors.Formal...
| Schlagworte: | ACNU, NSC-D 245382, N'-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-N-(2-chloroethyl)-N-nitroso-urea, monohydrochloride |
| Anwendung: | Nitrosourea alkylating agent, antineoplastic |
| CAS | 55661-38-6 |
| MW: | 309.2 D |
ab 94,00 €
