Zu "55576-66-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Agrimol B
Artikelnummer: TGM-T4S1173-100mg
Description: 1. Agrimol B is a main active ingredient isolated from Agrimonia pilosa Ledeb. Target: PPAR, Sirtuin. Smiles: CCCC(=O)c1c(O)c(Cc2c(O)c(Cc3c(O)c(C)c(OC)c(C(=O)CCC)c3O)c(O)c(C(=O)[C@@H](C)CC)c2O)c(O)c(C)c1OC. References: Chun S B, Yang B R, Choi C W, et al. Antibacterial Activities against Plant...
| Anwendung: | Polyphenol, adipogenesis inhibitory / anticancer agent |
| CAS | 55576-66-4 |
| MW: | 682.75 D |
ab 113,00 €
Agrimol B
Artikelnummer: Cay34996-1
Agrimol B is a polyphenol that has been found in A. pilosa with adipogenesis inhibitory and anticancer activities. It induces nuclear translocation of sirtuin 1 (SIRT1) and reduces expression of peroxisome proliferator-activated receptor gamma (PPARgamma), C/EBPalpha, and fatty acid synthase (FASN) in 3T3-L1...
| Schlagworte: | (2S)-1-[3,5-bis[[2,6-dihydroxy-4-methoxy-3-methyl-5-(1-oxobutyl)phenyl]methyl]-2,4,6-trihydroxyphenyl]-2-methyl-1-butanone |
| Anwendung: | Polyphenol, Adipogenesis inhibitory / anticancer agent |
| CAS | 55576-66-4 |
| MW: | 682.8 D |
ab 44,00 €
