Zu "555-60-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
CCCP
Artikelnummer: LKT-C084099.1
CCCP inhibits mitochondrial oxidative phosphorylation. SMILES: C1=CC(=CC(=C1)Cl)NN=C(C#N)C#N
| Schlagworte: | Carbonyl cyanide m-chlorophenyl hydrazone, Carbonyl cyanide 3-chlorophenylhydrazone, m-Cl-CCP, Mesoxalonitrile... |
| Anwendung: | Efflux pump inhibitor |
| CAS | 555-60-2 |
| MW: | 204.62 D |
ab 61,00 €
CCCP
Artikelnummer: TGM-T7081-100mg
Description: CCCP (Carbonyl Cyanide m-Chlorophenylhydrazone) is an oxidative phosphorylation (OXPHOS) inhibitor and mitochondrial proton carrier uncoupler. CCCP inhibits the activation of STING and its downstream signaling molecules TBK1 and IRF3. Target: Mitochondrial Metabolism, COX, IkappaB/IKK, Apoptosis,...
| Schlagworte: | Carbonyl Cyanide m-Chlorophenylhydrazone, Carbonyl cyanide 3-chlorophenylhydrazone |
| CAS | 555-60-2 |
| MW: | 204.62 D |
ab 42,00 €
CCCP
Artikelnummer: Cay25458-100
CCCP is a protonophore mitochondrial uncoupler that increases membrane permeability to protons, leading to a disruption in the mitochondrial membrane potential. It inhibits mitochondrial respiration and ATPase activity when used at concentrations of 110 and 35 nM, respectively. CCCP inhibits activation of...
| Schlagworte: | Carbonyl cyanide m-chlorophenyl hydrazone, NSC 88124, 2-[2-(3-chlorophenyl)hydrazinylidene]-propanedinitrile |
| Anwendung: | Protonophore mitochondrial uncoupler |
| CAS | 555-60-2 |
| MW: | 204.6 D |
ab 44,00 €
