Zu "552309-42-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
T16Ainh-A01
Artikelnummer: TGM-T13059-100mg
Description: T16Ainh-A01 is a potent inhibitor of TMEM16A Chloride channel, inhibiting TMEM16A-mediated chloride currents (IC50 of 1 µM),and functions as a calcium-activated chloride channel (CaCC). Target: Chloride channel. Smiles: CCc1c(C)[nH]c(SCC(=O)Nc2nc(cs2)-c2ccc(OC)cc2)nc1=O. References: Fedigan S, et al....
| Anwendung: | TMEM16A inhibitor, CaCC blocker |
| CAS | 552309-42-9 |
| MW: | 416.52 D |
ab 67,00 €
T16A(inh)-A01
Artikelnummer: Cay18518-10
Transmembrane protein 16A (TMEM16A, also known as anoctamin-1) is a calcium-activated chloride channel (CaCC) with roles in transepithelial anion transport and smooth muscle contraction. T16A(inh)-A01 is an aminophenylthiazole that inhibits transient TMEM16A-mediated chloride currents with an IC50 value of ~1 µM....
| Schlagworte: | 2-[(5-ethyl-1,6-dihydro-4-methyl-6-oxo-2-pyrimidinyl)thio]-N-[4-(4-methoxyphenyl)-2-thiazolyl]-acetamide |
| Anwendung: | TMEM16A inhibitor, CaCC blocker |
| CAS | 552309-42-9 |
| MW: | 416.5 D |
ab 44,00 €
