Zu "548461-82-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
JWH-149
Artikelnummer: TGM-T32336-10mg
Description: JWH 149, a synthetic cannabinoid (CB), can potently bind both the central CB1 receptor (Ki = 5.0 nM) and the peripheral CB2 receptor (Ki = 0.73 nM). Target: Others. Smiles: C(=O)(C=1C=2C(N(CCCCC)C1C)=CC=CC2)C=3C4=C(C(C)=CC3)C=CC=C4
| Anwendung: | Synthetic cannabinoid |
| CAS | 548461-82-1 |
| MW: | 369.5 D |
ab 108,00 €
JWH 149
Artikelnummer: Cay13978-1
JWH 149 (Cay-13978) is a synthetic cannabinoid (CB) which potently binds both the central CB1 receptor (Ki = 5.0 nM) and the peripheral CB2 receptor (Ki = 0.73 nM). Its physiological properties have not been elucidated. This product is intended for research and forensic applications.Formal Name:...
| Schlagworte: | (4-methyl-1-naphthalenyl)(2-methyl-1-pentyl-1H-indol-3-yl)-methanone |
| Anwendung: | Analytical reference standard, synthetic cannabinoid |
| CAS | 548461-82-1 |
| MW: | 369.5 D |
ab 241,00 €
